About (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium
(2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium (PubChem CID 176697763) has the molecular formula C7H14FOS+
and a molecular weight of 165.25 g/mol. Its IUPAC name is (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium.
Molecular Properties
| Compound Name | (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium |
| PubChem CID | 176697763 |
| Molecular Formula | C7H14FOS+ |
| Molecular Weight | 165.25 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium |
| SMILES | CC(C)(C)C(=O)C(F)C[SH2+] |
| InChI | InChI=1S/C7H13FOS/c1-7(2,3)6(9)5(8)4-10/h5,10H,4H2,1-3H3/p+1 |
| InChIKey | WLSRYZLOHICZQV-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium?
The IUPAC name of (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium (CID 176697763) is (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium.
What is the SMILES notation for (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium?
The canonical SMILES for (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium is CC(C)(C)C(=O)C(F)C[SH2+].
What is the InChIKey of (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium?
The InChIKey is WLSRYZLOHICZQV-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H13FOS/c1-7(2,3)6(9)5(8)4-10/h5,10H,4H2,1-3H3/p+1.
What are the key properties of (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium?
(2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium has a molecular weight of 165.25 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-4,4-dimethyl-3-oxopentyl)sulfanium is sourced from PubChem (CID 176697763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).