C18H25N3O4 — CID 176698408
(6S,6aS)-3-aminooxy-2,6-dimethoxy-5-methylspiro[6a,7,9,10-tetrahydro-6H-pyrido[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-12-one (PubChem CID 176698408) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is (6S,6aS)-3-aminooxy-2,6-dimethoxy-5-methylspiro[6a,7,9,10-tetrahydro-6H-pyrido[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-12-one.
| Compound Name | (6S,6aS)-3-aminooxy-2,6-dimethoxy-5-methylspiro[6a,7,9,10-tetrahydro-6H-pyrido[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-12-one |
|---|---|
| PubChem CID | 176698408 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (6S,6aS)-3-aminooxy-2,6-dimethoxy-5-methylspiro[6a,7,9,10-tetrahydro-6H-pyrido[2,1-c][1,4]benzodiazepine-8,1'-cyclopropane]-12-one |
| SMILES | COc1cc2c(cc1ON)N(C)[C@@H](OC)[C@@H]1CC3(CCN1C2=O)CC3 |
| InChI | InChI=1S/C18H25N3O4/c1-20-12-9-15(25-19)14(23-2)8-11(12)16(22)21-7-6-18(4-5-18)10-13(21)17(20)24-3/h8-9,13,17H,4-7,10,19H2,1-3H3/t13-,17-/m0/s1 |
| InChIKey | KQMNJKUXEBNNAG-GUYCJALGSA-N |
| XLogP | 1.75 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|