About ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane
ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane (PubChem CID 176698537) has the molecular formula C13H31NO5S
and a molecular weight of 313.46 g/mol. Its IUPAC name is ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane.
Molecular Properties
| Compound Name | ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane |
| PubChem CID | 176698537 |
| Molecular Formula | C13H31NO5S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane |
| SMILES | CCO.CCOCCCNC(=O)OCC.CCOSC |
| InChI | InChI=1S/C8H17NO3.C3H8OS.C2H6O/c1-3-11-7-5-6-9-8(10)12-4-2;1-3-4-5-2;1-2-3/h3-7H2,1-2H3,(H,9,10);3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | IFXUMBVYBFVOSH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane?
The IUPAC name of ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane (CID 176698537) is ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane.
What is the SMILES notation for ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane?
The canonical SMILES for ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane is CCO.CCOCCCNC(=O)OCC.CCOSC.
What is the InChIKey of ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane?
The InChIKey is IFXUMBVYBFVOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3.C3H8OS.C2H6O/c1-3-11-7-5-6-9-8(10)12-4-2;1-3-4-5-2;1-2-3/h3-7H2,1-2H3,(H,9,10);3H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane?
ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane has a molecular weight of 313.46 g/mol, XLogP of 2.46, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl N-(3-ethoxypropyl)carbamate;methylsulfanyloxyethane is sourced from PubChem (CID 176698537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).