About 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole
3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole (PubChem CID 176699706) has the molecular formula C7H9F2NS
and a molecular weight of 177.22 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole |
| PubChem CID | 176699706 |
| Molecular Formula | C7H9F2NS |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole |
| SMILES | CC(C)c1cc(C(F)F)ns1 |
| InChI | InChI=1S/C7H9F2NS/c1-4(2)6-3-5(7(8)9)10-11-6/h3-4,7H,1-2H3 |
| InChIKey | LTWTWYJYOSCUSE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole?
The IUPAC name of 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole (CID 176699706) is 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole.
What is the SMILES notation for 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole?
The canonical SMILES for 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole is CC(C)c1cc(C(F)F)ns1.
What is the InChIKey of 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole?
The InChIKey is LTWTWYJYOSCUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2NS/c1-4(2)6-3-5(7(8)9)10-11-6/h3-4,7H,1-2H3.
What are the key properties of 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole?
3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole has a molecular weight of 177.22 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-5-propan-2-yl-1,2-thiazole is sourced from PubChem (CID 176699706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).