C29H45N3O9 — CID 176700029
(Z)-but-2-ene;N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-6-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzamide (PubChem CID 176700029) has the molecular formula C29H45N3O9 and a molecular weight of 579.69 g/mol. Its IUPAC name is (Z)-but-2-ene;N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-6-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzamide.
| Compound Name | (Z)-but-2-ene;N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-6-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzamide |
|---|---|
| PubChem CID | 176700029 |
| Molecular Formula | C29H45N3O9 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.32 |
| IUPAC Name | (Z)-but-2-ene;N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]-6-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]benzamide |
| SMILES | C/C=C\C.CNC(=O)C(CCC=O)N(C=O)C(=O)c1c(C)cccc1NCCOCCOCCOCCOCC=O |
| InChI | InChI=1S/C25H37N3O9.C4H8/c1-20-5-3-6-21(23(20)25(33)28(19-31)22(7-4-9-29)24(32)26-2)27-8-11-34-13-15-36-17-18-37-16-14-35-12-10-30;1-3-4-2/h3,5-6,9-10,19,22,27H,4,7-8,11-18H2,1-2H3,(H,26,32);3-4H,1-2H3/b;4-3- |
| InChIKey | VGJJBBLPOSHRNJ-QGAMPUOQSA-N |
| XLogP | 1.95 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|