C15H24FNO3 — CID 176700476
N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]-2-methylpropanamide (PubChem CID 176700476) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 176700476 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-[2-[2-[(3E)-5-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]-2-methylpropanamide |
| SMILES | C=C(F)/C=C(/OCCOCCNC(=O)C(C)C)C(=C)C |
| InChI | InChI=1S/C15H24FNO3/c1-11(2)14(10-13(5)16)20-9-8-19-7-6-17-15(18)12(3)4/h10,12H,1,5-9H2,2-4H3,(H,17,18)/b14-10+ |
| InChIKey | GUZAPAGOSFPQBG-GXDHUFHOSA-N |
| XLogP | 2.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|