C18H25FN2O5 — CID 176700578
2-(prop-2-enoylamino)ethyl N-[2-[2-(2-ethyl-5-fluorophenoxy)ethoxy]ethyl]carbamate (PubChem CID 176700578) has the molecular formula C18H25FN2O5 and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-(prop-2-enoylamino)ethyl N-[2-[2-(2-ethyl-5-fluorophenoxy)ethoxy]ethyl]carbamate.
| Compound Name | 2-(prop-2-enoylamino)ethyl N-[2-[2-(2-ethyl-5-fluorophenoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176700578 |
| Molecular Formula | C18H25FN2O5 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-(prop-2-enoylamino)ethyl N-[2-[2-(2-ethyl-5-fluorophenoxy)ethoxy]ethyl]carbamate |
| SMILES | C=CC(=O)NCCOC(=O)NCCOCCOc1cc(F)ccc1CC |
| InChI | InChI=1S/C18H25FN2O5/c1-3-14-5-6-15(19)13-16(14)25-12-11-24-9-7-21-18(23)26-10-8-20-17(22)4-2/h4-6,13H,2-3,7-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ULZYPAVXWPMVPJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|