C21H29F3N2O5 — CID 176700782
(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl) N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;molecular hydrogen (PubChem CID 176700782) has the molecular formula C21H29F3N2O5 and a molecular weight of 446.47 g/mol. Its IUPAC name is (4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl) N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;molecular hydrogen.
| Compound Name | (4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl) N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 176700782 |
| Molecular Formula | C21H29F3N2O5 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl) N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;molecular hydrogen |
| SMILES | C=CC(=O)N1CC(OC(=O)NCCOCCOc2cc(F)ccc2C(C)C)C(F)(F)C1.[H][H] |
| InChI | InChI=1S/C21H27F3N2O5.H2/c1-4-19(27)26-12-18(21(23,24)13-26)31-20(28)25-7-8-29-9-10-30-17-11-15(22)5-6-16(17)14(2)3;/h4-6,11,14,18H,1,7-10,12-13H2,2-3H3,(H,25,28);1H |
| InChIKey | WRQNENNHHWHAML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|