About 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine
7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine (PubChem CID 176700835) has the molecular formula C21H18N2O2S
and a molecular weight of 362.45 g/mol. Its IUPAC name is 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine |
| PubChem CID | 176700835 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine |
| SMILES | COCCOc1ccccc1-c1nnc(-c2ccccc2)c2ccsc12 |
| InChI | InChI=1S/C21H18N2O2S/c1-24-12-13-25-18-10-6-5-9-16(18)20-21-17(11-14-26-21)19(22-23-20)15-7-3-2-4-8-15/h2-11,14H,12-13H2,1H3 |
| InChIKey | SHOKHAVBRYXFRZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine?
The IUPAC name of 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine (CID 176700835) is 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine.
What is the SMILES notation for 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine?
The canonical SMILES for 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine is COCCOc1ccccc1-c1nnc(-c2ccccc2)c2ccsc12.
What is the InChIKey of 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine?
The InChIKey is SHOKHAVBRYXFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2S/c1-24-12-13-25-18-10-6-5-9-16(18)20-21-17(11-14-26-21)19(22-23-20)15-7-3-2-4-8-15/h2-11,14H,12-13H2,1H3.
What are the key properties of 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine?
7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine has a molecular weight of 362.45 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(2-methoxyethoxy)phenyl]-4-phenylthieno[2,3-d]pyridazine is sourced from PubChem (CID 176700835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).