C18H22FNO2 — CID 176701236
N-[3-(5-fluoro-2-prop-1-en-2-ylphenoxy)cyclohexyl]prop-2-enamide (PubChem CID 176701236) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is N-[3-(5-fluoro-2-prop-1-en-2-ylphenoxy)cyclohexyl]prop-2-enamide.
| Compound Name | N-[3-(5-fluoro-2-prop-1-en-2-ylphenoxy)cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 176701236 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[3-(5-fluoro-2-prop-1-en-2-ylphenoxy)cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCC(Oc2cc(F)ccc2C(=C)C)C1 |
| InChI | InChI=1S/C18H22FNO2/c1-4-18(21)20-14-6-5-7-15(11-14)22-17-10-13(19)8-9-16(17)12(2)3/h4,8-10,14-15H,1-2,5-7,11H2,3H3,(H,20,21) |
| InChIKey | ODBPPWBYIFFUBW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|