C16H26FNO4 — CID 176701431
tert-butyl N-[2-[2-[(3Z)-4-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]carbamate (PubChem CID 176701431) has the molecular formula C16H26FNO4 and a molecular weight of 315.39 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(3Z)-4-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(3Z)-4-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176701431 |
| Molecular Formula | C16H26FNO4 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | tert-butyl N-[2-[2-[(3Z)-4-fluoro-2-methylhexa-1,3,5-trien-3-yl]oxyethoxy]ethyl]carbamate |
| SMILES | C=C/C(F)=C(/OCCOCCNC(=O)OC(C)(C)C)C(=C)C |
| InChI | InChI=1S/C16H26FNO4/c1-7-13(17)14(12(2)3)21-11-10-20-9-8-18-15(19)22-16(4,5)6/h7H,1-2,8-11H2,3-6H3,(H,18,19)/b14-13- |
| InChIKey | XAODCDJDTUWQAD-YPKPFQOOSA-N |
| XLogP | 3.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|