C12H22N2O — CID 176701585
1-(1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridin-2-yl)prop-2-en-1-one;ethane (PubChem CID 176701585) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-(1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridin-2-yl)prop-2-en-1-one;ethane.
| Compound Name | 1-(1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridin-2-yl)prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 176701585 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-(1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridin-2-yl)prop-2-en-1-one;ethane |
| SMILES | C=CC(=O)N1CC2CCNCC2C1.CC |
| InChI | InChI=1S/C10H16N2O.C2H6/c1-2-10(13)12-6-8-3-4-11-5-9(8)7-12;1-2/h2,8-9,11H,1,3-7H2;1-2H3 |
| InChIKey | LKBIJLUQUHENTL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|