C15H25N3O — CID 176701663
ethane;1-(2-ethyl-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one (PubChem CID 176701663) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is ethane;1-(2-ethyl-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one.
| Compound Name | ethane;1-(2-ethyl-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 176701663 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | ethane;1-(2-ethyl-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C)n2nc(CC)cc2C1C.CC |
| InChI | InChI=1S/C13H19N3O.C2H6/c1-5-11-7-12-10(4)15(13(17)6-2)8-9(3)16(12)14-11;1-2/h6-7,9-10H,2,5,8H2,1,3-4H3;1-2H3 |
| InChIKey | DFDAQPCMCYBOFV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|