C32H30F2N6O2S — CID 176702190
7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-(4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-4-(1-methylpyrrolo[3,2-b]pyridin-6-yl)thieno[3,2-c]pyridine (PubChem CID 176702190) has the molecular formula C32H30F2N6O2S and a molecular weight of 600.70 g/mol. Its IUPAC name is 7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-(4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-4-(1-methylpyrrolo[3,2-b]pyridin-6-yl)thieno[3,2-c]pyridine.
| Compound Name | 7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-(4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-4-(1-methylpyrrolo[3,2-b]pyridin-6-yl)thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 176702190 |
| Molecular Formula | C32H30F2N6O2S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-6-(4,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl)-4-(1-methylpyrrolo[3,2-b]pyridin-6-yl)thieno[3,2-c]pyridine |
| SMILES | COCCOc1cc(F)cc(F)c1-c1c(-c2cc3n(n2)C(C)CNC3C)nc(-c2cnc3ccn(C)c3c2)c2ccsc12 |
| InChI | InChI=1S/C32H30F2N6O2S/c1-17-15-35-18(2)25-14-24(38-40(17)25)31-29(28-22(34)12-20(33)13-27(28)42-9-8-41-4)32-21(6-10-43-32)30(37-31)19-11-26-23(36-16-19)5-7-39(26)3/h5-7,10-14,16-18,35H,8-9,15H2,1-4H3 |
| InChIKey | AZUGTZDIUDJAFT-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|