C33H27F3N6OS — CID 176702247
1-[(4R,7S)-2-[4-(2,4-difluoro-6-methylphenyl)-3-fluoro-7-(2-methylindazol-6-yl)thieno[2,3-c]pyridin-5-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one (PubChem CID 176702247) has the molecular formula C33H27F3N6OS and a molecular weight of 612.68 g/mol. Its IUPAC name is 1-[(4R,7S)-2-[4-(2,4-difluoro-6-methylphenyl)-3-fluoro-7-(2-methylindazol-6-yl)thieno[2,3-c]pyridin-5-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(4R,7S)-2-[4-(2,4-difluoro-6-methylphenyl)-3-fluoro-7-(2-methylindazol-6-yl)thieno[2,3-c]pyridin-5-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176702247 |
| Molecular Formula | C33H27F3N6OS |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 1-[(4R,7S)-2-[4-(2,4-difluoro-6-methylphenyl)-3-fluoro-7-(2-methylindazol-6-yl)thieno[2,3-c]pyridin-5-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)n2nc(-c3nc(-c4ccc5cn(C)nc5c4)c4scc(F)c4c3-c3c(C)cc(F)cc3F)cc2[C@H]1C |
| InChI | InChI=1S/C33H27F3N6OS/c1-6-27(43)41-13-17(3)42-26(18(41)4)12-25(39-42)32-30(28-16(2)9-21(34)11-22(28)35)29-23(36)15-44-33(29)31(37-32)19-7-8-20-14-40(5)38-24(20)10-19/h6-12,14-15,17-18H,1,13H2,2-5H3/t17-,18+/m0/s1 |
| InChIKey | AIIRMVSHOUFWFI-ZWKOTPCHSA-N |
| XLogP | 7.76 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|