C10H14N4O — CID 176702522
1-(4,4-dimethyl-6,7-dihydrotriazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one (PubChem CID 176702522) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-(4,4-dimethyl-6,7-dihydrotriazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one.
| Compound Name | 1-(4,4-dimethyl-6,7-dihydrotriazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 176702522 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-(4,4-dimethyl-6,7-dihydrotriazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCn2nncc2C1(C)C |
| InChI | InChI=1S/C10H14N4O/c1-4-9(15)13-5-6-14-8(7-11-12-14)10(13,2)3/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | FVDQBGBTXILUQS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|