C27H33ClN6O4 — CID 176703663
(Z)-2-amino-3-[1-(5-chloro-6-hydroxy-2'-methoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl)-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide (PubChem CID 176703663) has the molecular formula C27H33ClN6O4 and a molecular weight of 541.05 g/mol. Its IUPAC name is (Z)-2-amino-3-[1-(5-chloro-6-hydroxy-2'-methoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl)-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | (Z)-2-amino-3-[1-(5-chloro-6-hydroxy-2'-methoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl)-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 176703663 |
| Molecular Formula | C27H33ClN6O4 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | (Z)-2-amino-3-[1-(5-chloro-6-hydroxy-2'-methoxyspiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl)-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N,N-dimethylprop-2-enamide |
| SMILES | COc1nc2c(c(N3CCCN=C(/C=C(\N)C(=O)N(C)C)C3)n1)COC1(CCCc3ccc(O)c(Cl)c31)C2 |
| InChI | InChI=1S/C27H33ClN6O4/c1-33(2)25(36)19(29)12-17-14-34(11-5-10-30-17)24-18-15-38-27(13-20(18)31-26(32-24)37-3)9-4-6-16-7-8-21(35)23(28)22(16)27/h7-8,12,35H,4-6,9-11,13-15,29H2,1-3H3/b19-12- |
| InChIKey | UVCVBSRVBOOODC-UNOMPAQXSA-N |
| XLogP | 2.73 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|