C33H46FN7O — CID 176703772
2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine;[3-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-yl]cyanamide (PubChem CID 176703772) has the molecular formula C33H46FN7O and a molecular weight of 575.78 g/mol. Its IUPAC name is 2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine;[3-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-yl]cyanamide.
| Compound Name | 2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine;[3-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-yl]cyanamide |
|---|---|
| PubChem CID | 176703772 |
| Molecular Formula | C33H46FN7O |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.37 |
| IUPAC Name | 2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine;[3-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-yl]cyanamide |
| SMILES | CCCc1ccccc1C1Cc2nc(OC)nc(N3CC4CCC(C3)C4NC#N)c2CN1C.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C26H34N6O.C7H12FN/c1-4-7-17-8-5-6-9-20(17)23-12-22-21(15-31(23)2)25(30-26(29-22)33-3)32-13-18-10-11-19(14-32)24(18)28-16-27;8-6-4-7-2-1-3-9(7)5-6/h5-6,8-9,18-19,23-24,28H,4,7,10-15H2,1-3H3;6-7H,1-5H2 |
| InChIKey | VEXBNEJPVIMFOA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|