C31H43ClN6O3 — CID 176703815
(E)-2-[(E)-chloro-[4-[7-(2-ethyl-6-hydroxyphenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,4-diazepan-2-ylidene]methyl]-N,N,3-trimethylpent-2-enamide (PubChem CID 176703815) has the molecular formula C31H43ClN6O3 and a molecular weight of 583.18 g/mol. Its IUPAC name is (E)-2-[(E)-chloro-[4-[7-(2-ethyl-6-hydroxyphenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,4-diazepan-2-ylidene]methyl]-N,N,3-trimethylpent-2-enamide.
| Compound Name | (E)-2-[(E)-chloro-[4-[7-(2-ethyl-6-hydroxyphenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,4-diazepan-2-ylidene]methyl]-N,N,3-trimethylpent-2-enamide |
|---|---|
| PubChem CID | 176703815 |
| Molecular Formula | C31H43ClN6O3 |
| Molecular Weight | 583.18 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | (E)-2-[(E)-chloro-[4-[7-(2-ethyl-6-hydroxyphenyl)-2-methoxy-6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-1,4-diazepan-2-ylidene]methyl]-N,N,3-trimethylpent-2-enamide |
| SMILES | CC/C(C)=C(C(=O)N(C)C)/C(Cl)=C1/CN(c2nc(OC)nc3c2CN(C)C(c2c(O)cccc2CC)C3)CCCN1 |
| InChI | InChI=1S/C31H43ClN6O3/c1-8-19(3)26(30(40)36(4)5)28(32)23-18-38(15-11-14-33-23)29-21-17-37(6)24(16-22(21)34-31(35-29)41-7)27-20(9-2)12-10-13-25(27)39/h10,12-13,24,33,39H,8-9,11,14-18H2,1-7H3/b26-19-,28-23+ |
| InChIKey | WZMOZHCAYHHZCJ-KVUPLNMOSA-N |
| XLogP | 4.55 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|