C14H23ClN6 — CID 176703892
3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine (PubChem CID 176703892) has the molecular formula C14H23ClN6 and a molecular weight of 310.83 g/mol. Its IUPAC name is 3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine.
| Compound Name | 3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 176703892 |
| Molecular Formula | C14H23ClN6 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-propan-2-yl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
| SMILES | CC1N=C(c2nn3c(c2Cl)CN(C(C)C)CCC3)N(C)N1 |
| InChI | InChI=1S/C14H23ClN6/c1-9(2)20-6-5-7-21-11(8-20)12(15)13(18-21)14-16-10(3)17-19(14)4/h9-10,17H,5-8H2,1-4H3 |
| InChIKey | PKLPDPHKDVXBRA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |