C27H39ClN10O — CID 176703916
(E)-N,N',2-triamino-3-chloro-3-[1-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N-methylprop-2-enimidamide (PubChem CID 176703916) has the molecular formula C27H39ClN10O and a molecular weight of 555.13 g/mol. Its IUPAC name is (E)-N,N',2-triamino-3-chloro-3-[1-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N-methylprop-2-enimidamide.
| Compound Name | (E)-N,N',2-triamino-3-chloro-3-[1-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N-methylprop-2-enimidamide |
|---|---|
| PubChem CID | 176703916 |
| Molecular Formula | C27H39ClN10O |
| Molecular Weight | 555.13 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | (E)-N,N',2-triamino-3-chloro-3-[1-[2-methoxy-6-methyl-7-(2-propylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]-N-methylprop-2-enimidamide |
| SMILES | CCCc1ccccc1C1Cc2nc(OC)nc(N3CCCN=C(/C(Cl)=C(N)/C(=N/N)N(C)N)C3)c2CN1C |
| InChI | InChI=1S/C27H39ClN10O/c1-5-9-17-10-6-7-11-18(17)22-14-20-19(15-36(22)2)25(34-27(33-20)39-4)38-13-8-12-32-21(16-38)23(28)24(29)26(35-30)37(3)31/h6-7,10-11,22H,5,8-9,12-16,29-31H2,1-4H3/b24-23+,35-26- |
| InChIKey | FCFUTALYHLADCR-AKSLIKNQSA-N |
| XLogP | 2.30 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|