C23H40N2 — CID 176704078
(2S,4Z,6Z)-6-(5-methylcyclooctyl)-4-[(E)-3-methyl-4-methyliminobut-2-en-2-yl]octa-4,6-dien-2-amine (PubChem CID 176704078) has the molecular formula C23H40N2 and a molecular weight of 344.59 g/mol. Its IUPAC name is (2S,4Z,6Z)-6-(5-methylcyclooctyl)-4-[(E)-3-methyl-4-methyliminobut-2-en-2-yl]octa-4,6-dien-2-amine.
| Compound Name | (2S,4Z,6Z)-6-(5-methylcyclooctyl)-4-[(E)-3-methyl-4-methyliminobut-2-en-2-yl]octa-4,6-dien-2-amine |
|---|---|
| PubChem CID | 176704078 |
| Molecular Formula | C23H40N2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | (2S,4Z,6Z)-6-(5-methylcyclooctyl)-4-[(E)-3-methyl-4-methyliminobut-2-en-2-yl]octa-4,6-dien-2-amine |
| SMILES | C/C=C(\C=C(C[C@H](C)N)/C(C)=C(C)/C=N/C)C1CCCC(C)CCC1 |
| InChI | InChI=1S/C23H40N2/c1-7-21(22-12-8-10-17(2)11-9-13-22)15-23(14-19(4)24)20(5)18(3)16-25-6/h7,15-17,19,22H,8-14,24H2,1-6H3/b20-18+,21-7+,23-15-,25-16+/t17?,19-,22?/m0/s1 |
| InChIKey | TVFGZYZKZBWPLL-ZCJDDGPCSA-N |
| XLogP | 6.24 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|