C16H21FN2 — CID 176704616
(4E)-N,5-bis(ethenyl)-6-[[(E)-2-fluorobut-2-enylidene]amino]-2-methylhepta-2,4,6-trien-3-amine (PubChem CID 176704616) has the molecular formula C16H21FN2 and a molecular weight of 260.36 g/mol. Its IUPAC name is (4E)-N,5-bis(ethenyl)-6-[[(E)-2-fluorobut-2-enylidene]amino]-2-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (4E)-N,5-bis(ethenyl)-6-[[(E)-2-fluorobut-2-enylidene]amino]-2-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176704616 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (4E)-N,5-bis(ethenyl)-6-[[(E)-2-fluorobut-2-enylidene]amino]-2-methylhepta-2,4,6-trien-3-amine |
| SMILES | C=CNC(C=C(C=C)C(=C)/N=C/C(F)=C\C)=C(C)C |
| InChI | InChI=1S/C16H21FN2/c1-7-14(10-16(12(4)5)18-9-3)13(6)19-11-15(17)8-2/h7-11,18H,1,3,6H2,2,4-5H3/b14-10+,15-8+,19-11+ |
| InChIKey | HYSFDQOEZPVLHQ-VDWWAXQFSA-N |
| XLogP | 4.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|