C26H26ClN7O2 — CID 176704713
N-[amino-[3-[[[5-(2-chloro-4,6-dimethylpyrimidin-5-yl)pyrazolo[1,5-a]pyridin-3-yl]-hydroxymethyl]amino]-4-methylphenyl]methylidene]cyclopropanecarboxamide (PubChem CID 176704713) has the molecular formula C26H26ClN7O2 and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[amino-[3-[[[5-(2-chloro-4,6-dimethylpyrimidin-5-yl)pyrazolo[1,5-a]pyridin-3-yl]-hydroxymethyl]amino]-4-methylphenyl]methylidene]cyclopropanecarboxamide.
| Compound Name | N-[amino-[3-[[[5-(2-chloro-4,6-dimethylpyrimidin-5-yl)pyrazolo[1,5-a]pyridin-3-yl]-hydroxymethyl]amino]-4-methylphenyl]methylidene]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 176704713 |
| Molecular Formula | C26H26ClN7O2 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N-[amino-[3-[[[5-(2-chloro-4,6-dimethylpyrimidin-5-yl)pyrazolo[1,5-a]pyridin-3-yl]-hydroxymethyl]amino]-4-methylphenyl]methylidene]cyclopropanecarboxamide |
| SMILES | Cc1ccc(/C(N)=N/C(=O)C2CC2)cc1NC(O)c1cnn2ccc(-c3c(C)nc(Cl)nc3C)cc12 |
| InChI | InChI=1S/C26H26ClN7O2/c1-13-4-5-18(23(28)33-24(35)16-6-7-16)10-20(13)32-25(36)19-12-29-34-9-8-17(11-21(19)34)22-14(2)30-26(27)31-15(22)3/h4-5,8-12,16,25,32,36H,6-7H2,1-3H3,(H2,28,33,35) |
| InChIKey | MBLCSQHLXVSXOV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 130.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|