C13H21F3N2 — CID 176704958
(Z)-N-propan-2-yl-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine (PubChem CID 176704958) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is (Z)-N-propan-2-yl-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine.
| Compound Name | (Z)-N-propan-2-yl-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine |
|---|---|
| PubChem CID | 176704958 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (Z)-N-propan-2-yl-1-[(E)-[(E)-1,1,1-trifluorohept-3-en-2-ylidene]amino]prop-1-en-1-amine |
| SMILES | C/C=C(\N=C(/C=C/CCC)C(F)(F)F)NC(C)C |
| InChI | InChI=1S/C13H21F3N2/c1-5-7-8-9-11(13(14,15)16)18-12(6-2)17-10(3)4/h6,8-10,17H,5,7H2,1-4H3/b9-8+,12-6-,18-11+ |
| InChIKey | MJOJJHORZMCADJ-SIEUNCANSA-N |
| XLogP | 4.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|