About ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate
ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate (PubChem CID 176706720) has the molecular formula C15H31NO6S
and a molecular weight of 353.48 g/mol. Its IUPAC name is ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate.
Molecular Properties
| Compound Name | ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate |
| PubChem CID | 176706720 |
| Molecular Formula | C15H31NO6S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate |
| SMILES | CC.CC.COC(=O)OC1CCN(C(=O)CCS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H19NO6S.2C2H6/c1-17-11(14)18-9-3-6-12(7-4-9)10(13)5-8-19(2,15)16;2*1-2/h9H,3-8H2,1-2H3;2*1-2H3 |
| InChIKey | YOFHFVMNXLICJY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate?
The IUPAC name of ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate (CID 176706720) is ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate.
What is the SMILES notation for ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate?
The canonical SMILES for ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate is CC.CC.COC(=O)OC1CCN(C(=O)CCS(C)(=O)=O)CC1.
What is the InChIKey of ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate?
The InChIKey is YOFHFVMNXLICJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO6S.2C2H6/c1-17-11(14)18-9-3-6-12(7-4-9)10(13)5-8-19(2,15)16;2*1-2/h9H,3-8H2,1-2H3;2*1-2H3.
What are the key properties of ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate?
ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate has a molecular weight of 353.48 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl [1-(3-methylsulfonylpropanoyl)piperidin-4-yl] carbonate is sourced from PubChem (CID 176706720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).