About 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate
3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate (PubChem CID 176706807) has the molecular formula C14H25F3N2O5
and a molecular weight of 358.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate |
| PubChem CID | 176706807 |
| Molecular Formula | C14H25F3N2O5 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate |
| SMILES | CC(C)(C)CC(=O)N1CC[C@@H](C(F)(F)F)C1.COC(N)=O.O=CO |
| InChI | InChI=1S/C11H18F3NO.C2H5NO2.CH2O2/c1-10(2,3)6-9(16)15-5-4-8(7-15)11(12,13)14;1-5-2(3)4;2-1-3/h8H,4-7H2,1-3H3;1H3,(H2,3,4);1H,(H,2,3)/t8-;;/m1../s1 |
| InChIKey | IZKIMSYZCPWGHK-YCBDHFTFSA-N |
| XLogP | 2.25 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate?
The IUPAC name of 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate (CID 176706807) is 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate.
What is the SMILES notation for 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate?
The canonical SMILES for 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate is CC(C)(C)CC(=O)N1CC[C@@H](C(F)(F)F)C1.COC(N)=O.O=CO.
What is the InChIKey of 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate?
The InChIKey is IZKIMSYZCPWGHK-YCBDHFTFSA-N. The full InChI is InChI=1S/C11H18F3NO.C2H5NO2.CH2O2/c1-10(2,3)6-9(16)15-5-4-8(7-15)11(12,13)14;1-5-2(3)4;2-1-3/h8H,4-7H2,1-3H3;1H3,(H2,3,4);1H,(H,2,3)/t8-;;/m1../s1.
What are the key properties of 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate?
3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate has a molecular weight of 358.36 g/mol, XLogP of 2.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate is sourced from PubChem (CID 176706807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).