About N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane
N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane (PubChem CID 176707596) has the molecular formula C8H15F2N
and a molecular weight of 163.21 g/mol. Its IUPAC name is N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane.
Molecular Properties
| Compound Name | N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane |
| PubChem CID | 176707596 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane |
| SMILES | CC.CC(C)=N/C(F)=C(\C)F |
| InChI | InChI=1S/C6H9F2N.C2H6/c1-4(2)9-6(8)5(3)7;1-2/h1-3H3;1-2H3/b6-5+; |
| InChIKey | BKVNCPNDIMOMRU-IPZCTEOASA-N |
| XLogP | 3.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane?
The IUPAC name of N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane (CID 176707596) is N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane.
What is the SMILES notation for N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane?
The canonical SMILES for N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane is CC.CC(C)=N/C(F)=C(\C)F.
What is the InChIKey of N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane?
The InChIKey is BKVNCPNDIMOMRU-IPZCTEOASA-N. The full InChI is InChI=1S/C6H9F2N.C2H6/c1-4(2)9-6(8)5(3)7;1-2/h1-3H3;1-2H3/b6-5+;.
What are the key properties of N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane?
N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane has a molecular weight of 163.21 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1,2-difluoroprop-1-enyl]propan-2-imine;ethane is sourced from PubChem (CID 176707596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).