About 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane
5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane (PubChem CID 176709828) has the molecular formula C10H13F2NO3
and a molecular weight of 233.21 g/mol. Its IUPAC name is 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane.
Molecular Properties
| Compound Name | 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane |
| PubChem CID | 176709828 |
| Molecular Formula | C10H13F2NO3 |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane |
| SMILES | CC.O=Cc1ccc(OC(F)(F)CO)cn1 |
| InChI | InChI=1S/C8H7F2NO3.C2H6/c9-8(10,5-13)14-7-2-1-6(4-12)11-3-7;1-2/h1-4,13H,5H2;1-2H3 |
| InChIKey | SOBXMKBITWWPPK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane?
The IUPAC name of 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane (CID 176709828) is 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane.
What is the SMILES notation for 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane?
The canonical SMILES for 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane is CC.O=Cc1ccc(OC(F)(F)CO)cn1.
What is the InChIKey of 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane?
The InChIKey is SOBXMKBITWWPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO3.C2H6/c9-8(10,5-13)14-7-2-1-6(4-12)11-3-7;1-2/h1-4,13H,5H2;1-2H3.
What are the key properties of 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane?
5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane has a molecular weight of 233.21 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane is sourced from PubChem (CID 176709828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).