C10H13F2NO3 — CID 176709828
5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane (PubChem CID 176709828) has the molecular formula C10H13F2NO3 and a molecular weight of 233.21 g/mol. Its IUPAC name is 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane.
| Compound Name | 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane |
|---|---|
| PubChem CID | 176709828 |
| Molecular Formula | C10H13F2NO3 |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 5-(1,1-difluoro-2-hydroxyethoxy)pyridine-2-carbaldehyde;ethane |
| SMILES | CC.O=Cc1ccc(OC(F)(F)CO)cn1 |
| InChI | InChI=1S/C8H7F2NO3.C2H6/c9-8(10,5-13)14-7-2-1-6(4-12)11-3-7;1-2/h1-4,13H,5H2;1-2H3 |
| InChIKey | SOBXMKBITWWPPK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|