C19H19N5O3S — CID 176709968
2-amino-4-[6-(2-methoxyethoxy)-3-pyridinyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile (PubChem CID 176709968) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-amino-4-[6-(2-methoxyethoxy)-3-pyridinyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[6-(2-methoxyethoxy)-3-pyridinyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176709968 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-amino-4-[6-(2-methoxyethoxy)-3-pyridinyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile |
| SMILES | COCCOc1ccc(-c2c(C#N)c(N)nc(SCC3COC3)c2C#N)cn1 |
| InChI | InChI=1S/C19H19N5O3S/c1-25-4-5-27-16-3-2-13(8-23-16)17-14(6-20)18(22)24-19(15(17)7-21)28-11-12-9-26-10-12/h2-3,8,12H,4-5,9-11H2,1H3,(H2,22,24) |
| InChIKey | TYSRKRZYDTYXQW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|