About N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide
N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide (PubChem CID 176711047) has the molecular formula C12H12N4O3S2
and a molecular weight of 324.39 g/mol. Its IUPAC name is N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide |
| PubChem CID | 176711047 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide |
| SMILES | COc1nc(NS(=O)(=O)c2c[nH]c3cc(C)ccc23)ns1 |
| InChI | InChI=1S/C12H12N4O3S2/c1-7-3-4-8-9(5-7)13-6-10(8)21(17,18)16-11-14-12(19-2)20-15-11/h3-6,13H,1-2H3,(H,15,16) |
| InChIKey | VITHMLUCZVOVGO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide?
The IUPAC name of N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide (CID 176711047) is N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide.
What is the SMILES notation for N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide?
The canonical SMILES for N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide is COc1nc(NS(=O)(=O)c2c[nH]c3cc(C)ccc23)ns1.
What is the InChIKey of N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide?
The InChIKey is VITHMLUCZVOVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O3S2/c1-7-3-4-8-9(5-7)13-6-10(8)21(17,18)16-11-14-12(19-2)20-15-11/h3-6,13H,1-2H3,(H,15,16).
What are the key properties of N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide?
N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide has a molecular weight of 324.39 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methoxy-1,2,4-thiadiazol-3-yl)-6-methyl-1H-indole-3-sulfonamide is sourced from PubChem (CID 176711047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).