C34H47F3N6 — CID 176712407
6-amino-3-[(2S)-butan-2-yl]-2-[2-ethyl-4-(2-ethyl-3,3-difluoroazetidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176712407) has the molecular formula C34H47F3N6 and a molecular weight of 596.79 g/mol. Its IUPAC name is 6-amino-3-[(2S)-butan-2-yl]-2-[2-ethyl-4-(2-ethyl-3,3-difluoroazetidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 6-amino-3-[(2S)-butan-2-yl]-2-[2-ethyl-4-(2-ethyl-3,3-difluoroazetidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176712407 |
| Molecular Formula | C34H47F3N6 |
| Molecular Weight | 596.79 g/mol |
| Exact Mass | 596.38 |
| IUPAC Name | 6-amino-3-[(2S)-butan-2-yl]-2-[2-ethyl-4-(2-ethyl-3,3-difluoroazetidin-1-yl)-5,6,7,8-tetrahydroquinazolin-7-yl]benzonitrile;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC12CCCN1CC(F)C2.CCc1nc2c(c(N3CC(F)(F)C3CC)n1)CCC(c1c([C@@H](C)CC)ccc(N)c1C#N)C2 |
| InChI | InChI=1S/C26H33F2N5.C8H14FN/c1-5-15(4)17-10-11-20(30)19(13-29)24(17)16-8-9-18-21(12-16)31-23(7-3)32-25(18)33-14-26(27,28)22(33)6-2;1-8-3-2-4-10(8)6-7(9)5-8/h10-11,15-16,22H,5-9,12,14,30H2,1-4H3;7H,2-6H2,1H3/t15-,16?,22?;/m0./s1 |
| InChIKey | JQGBCNKGNNRGFD-MNVGOUSESA-N |
| XLogP | 7.10 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.79 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|