C23H36N4 — CID 176713333
5,13-dimethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15-heptaene;ethane (PubChem CID 176713333) has the molecular formula C23H36N4 and a molecular weight of 368.57 g/mol. Its IUPAC name is 5,13-dimethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15-heptaene;ethane.
| Compound Name | 5,13-dimethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15-heptaene;ethane |
|---|---|
| PubChem CID | 176713333 |
| Molecular Formula | C23H36N4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 5,13-dimethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15-heptaene;ethane |
| SMILES | CC.CC.CC.CN1CC2=CCCC=C2c2nnn(C)c2-c2ccccc21 |
| InChI | InChI=1S/C17H18N4.3C2H6/c1-20-11-12-7-3-4-8-13(12)16-17(21(2)19-18-16)14-9-5-6-10-15(14)20;3*1-2/h5-10H,3-4,11H2,1-2H3;3*1-2H3 |
| InChIKey | IXKQEMOUOUBNHD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |