C25H35N3 — CID 176713409
(11Z)-11-N-(3,4,4,5-tetramethylhexan-3-yl)-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine (PubChem CID 176713409) has the molecular formula C25H35N3 and a molecular weight of 377.58 g/mol. Its IUPAC name is (11Z)-11-N-(3,4,4,5-tetramethylhexan-3-yl)-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine.
| Compound Name | (11Z)-11-N-(3,4,4,5-tetramethylhexan-3-yl)-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine |
|---|---|
| PubChem CID | 176713409 |
| Molecular Formula | C25H35N3 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | (11Z)-11-N-(3,4,4,5-tetramethylhexan-3-yl)-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine |
| SMILES | CCC(C)(N/C1=C(\N)c2ccccc2NCc2ccccc21)C(C)(C)C(C)C |
| InChI | InChI=1S/C25H35N3/c1-7-25(6,24(4,5)17(2)3)28-23-19-13-9-8-12-18(19)16-27-21-15-11-10-14-20(21)22(23)26/h8-15,17,27-28H,7,16,26H2,1-6H3/b23-22- |
| InChIKey | TWXRWRKIEFPKTF-FCQUAONHSA-N |
| XLogP | 5.84 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|