C25H30F3N5O — CID 176713808
N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[1-[3-(difluoromethyl)phenyl]pyrazol-4-yl]propanamide;4-fluorohex-1-ene (PubChem CID 176713808) has the molecular formula C25H30F3N5O and a molecular weight of 473.54 g/mol. Its IUPAC name is N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[1-[3-(difluoromethyl)phenyl]pyrazol-4-yl]propanamide;4-fluorohex-1-ene.
| Compound Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[1-[3-(difluoromethyl)phenyl]pyrazol-4-yl]propanamide;4-fluorohex-1-ene |
|---|---|
| PubChem CID | 176713808 |
| Molecular Formula | C25H30F3N5O |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-[1-[3-(difluoromethyl)phenyl]pyrazol-4-yl]propanamide;4-fluorohex-1-ene |
| SMILES | C=CCC(F)CC.CC(C(=O)Nc1cc(C2CC2)[nH]n1)c1cnn(-c2cccc(C(F)F)c2)c1 |
| InChI | InChI=1S/C19H19F2N5O.C6H11F/c1-11(19(27)23-17-8-16(24-25-17)12-5-6-12)14-9-22-26(10-14)15-4-2-3-13(7-15)18(20)21;1-3-5-6(7)4-2/h2-4,7-12,18H,5-6H2,1H3,(H2,23,24,25,27);3,6H,1,4-5H2,2H3 |
| InChIKey | CONVDZKJPOQSDL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|