C18H20ClF3N2O6S — CID 176714114
[(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate;2-methoxyacetaldehyde (PubChem CID 176714114) has the molecular formula C18H20ClF3N2O6S and a molecular weight of 484.88 g/mol. Its IUPAC name is [(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate;2-methoxyacetaldehyde.
| Compound Name | [(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate;2-methoxyacetaldehyde |
|---|---|
| PubChem CID | 176714114 |
| Molecular Formula | C18H20ClF3N2O6S |
| Molecular Weight | 484.88 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | [(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate;2-methoxyacetaldehyde |
| SMILES | COCC=O.COc1cc2c3c(c(OS(=O)(=O)C(F)(F)F)nc2cc1Cl)CN(C)[C@H]3C |
| InChI | InChI=1S/C15H14ClF3N2O4S.C3H6O2/c1-7-13-8-4-12(24-3)10(16)5-11(8)20-14(9(13)6-21(7)2)25-26(22,23)15(17,18)19;1-5-3-2-4/h4-5,7H,6H2,1-3H3;2H,3H2,1H3/t7-;/m0./s1 |
| InChIKey | UOICCEOXNQYOFX-FJXQXJEOSA-N |
| XLogP | 3.46 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|