C15H14ClF3N2O4S — CID 176714115
[(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate (PubChem CID 176714115) has the molecular formula C15H14ClF3N2O4S and a molecular weight of 410.80 g/mol. Its IUPAC name is [(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176714115 |
| Molecular Formula | C15H14ClF3N2O4S |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | [(1S)-7-chloro-8-methoxy-1,2-dimethyl-1,3-dihydropyrrolo[3,4-c]quinolin-4-yl] trifluoromethanesulfonate |
| SMILES | COc1cc2c3c(c(OS(=O)(=O)C(F)(F)F)nc2cc1Cl)CN(C)[C@H]3C |
| InChI | InChI=1S/C15H14ClF3N2O4S/c1-7-13-8-4-12(24-3)10(16)5-11(8)20-14(9(13)6-21(7)2)25-26(22,23)15(17,18)19/h4-5,7H,6H2,1-3H3/t7-/m0/s1 |
| InChIKey | WSEQMDSHLAMPFY-ZETCQYMHSA-N |
| XLogP | 3.63 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|