C27H21FN8O3 — CID 176714346
4-[1-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-(1,2-oxazol-3-yloxy)-1,3,5-triazin-2-yl]imidazol-4-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 176714346) has the molecular formula C27H21FN8O3 and a molecular weight of 524.52 g/mol. Its IUPAC name is 4-[1-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-(1,2-oxazol-3-yloxy)-1,3,5-triazin-2-yl]imidazol-4-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[1-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-(1,2-oxazol-3-yloxy)-1,3,5-triazin-2-yl]imidazol-4-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 176714346 |
| Molecular Formula | C27H21FN8O3 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 4-[1-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-(1,2-oxazol-3-yloxy)-1,3,5-triazin-2-yl]imidazol-4-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3cn(-c4nc(Oc5ccon5)nc(N5C[C@H]6CC[C@@H](C5)N6)n4)cn3)c12 |
| InChI | InChI=1S/C27H21FN8O3/c1-2-19-21(28)6-3-15-9-18(37)10-20(24(15)19)22-13-36(14-29-22)26-31-25(35-11-16-4-5-17(12-35)30-16)32-27(33-26)39-23-7-8-38-34-23/h1,3,6-10,13-14,16-17,30,37H,4-5,11-12H2/t16-,17+ |
| InChIKey | XNCRIZLARXPFKN-CALCHBBNSA-N |
| XLogP | 3.42 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|