About (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane
(5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 176714376) has the molecular formula C7H13FN2
and a molecular weight of 144.19 g/mol. Its IUPAC name is (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane |
| PubChem CID | 176714376 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CN1C2CNC[C@@H]1C(F)C2 |
| InChI | InChI=1S/C7H13FN2/c1-10-5-2-6(8)7(10)4-9-3-5/h5-7,9H,2-4H2,1H3/t5?,6?,7-/m1/s1 |
| InChIKey | ZPDHHJODTIQAMB-KPGICGJXSA-N |
| XLogP | 0.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane?
The IUPAC name of (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane (CID 176714376) is (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane.
What is the SMILES notation for (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane?
The canonical SMILES for (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane is CN1C2CNC[C@@H]1C(F)C2.
What is the InChIKey of (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane?
The InChIKey is ZPDHHJODTIQAMB-KPGICGJXSA-N. The full InChI is InChI=1S/C7H13FN2/c1-10-5-2-6(8)7(10)4-9-3-5/h5-7,9H,2-4H2,1H3/t5?,6?,7-/m1/s1.
What are the key properties of (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane?
(5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane has a molecular weight of 144.19 g/mol, XLogP of 0.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-6-fluoro-8-methyl-3,8-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 176714376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).