C16H17F3N4O3 — CID 176715091
5-[[4-(formamidomethyl)phenyl]methylamino]pyrazine-2-carboxylic acid;1,1,1-trifluoroethane (PubChem CID 176715091) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is 5-[[4-(formamidomethyl)phenyl]methylamino]pyrazine-2-carboxylic acid;1,1,1-trifluoroethane.
| Compound Name | 5-[[4-(formamidomethyl)phenyl]methylamino]pyrazine-2-carboxylic acid;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 176715091 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-[[4-(formamidomethyl)phenyl]methylamino]pyrazine-2-carboxylic acid;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.O=CNCc1ccc(CNc2cnc(C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C14H14N4O3.C2H3F3/c19-9-15-5-10-1-3-11(4-2-10)6-17-13-8-16-12(7-18-13)14(20)21;1-2(3,4)5/h1-4,7-9H,5-6H2,(H,15,19)(H,17,18)(H,20,21);1H3 |
| InChIKey | PDSFHXVDSJNZSM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|