C11H20N2 — CID 176715330
(2S,3E,5Z)-7-methylimino-N-propylhepta-3,5-dien-2-amine (PubChem CID 176715330) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is (2S,3E,5Z)-7-methylimino-N-propylhepta-3,5-dien-2-amine.
| Compound Name | (2S,3E,5Z)-7-methylimino-N-propylhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 176715330 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (2S,3E,5Z)-7-methylimino-N-propylhepta-3,5-dien-2-amine |
| SMILES | CCCN[C@@H](C)/C=C/C=C\C=N\C |
| InChI | InChI=1S/C11H20N2/c1-4-9-13-11(2)8-6-5-7-10-12-3/h5-8,10-11,13H,4,9H2,1-3H3/b7-5-,8-6+,12-10+/t11-/m0/s1 |
| InChIKey | KOWQFLXSFYZNCR-FCWYFNCZSA-N |
| XLogP | 2.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|