About 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine
1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine (PubChem CID 176715676) has the molecular formula C21H24FN3
and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine |
| PubChem CID | 176715676 |
| Molecular Formula | C21H24FN3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine |
| SMILES | C=CN1CCC(F)C1.Cc1ccc(-n2ccc3cc(C)cnc32)cc1 |
| InChI | InChI=1S/C15H14N2.C6H10FN/c1-11-3-5-14(6-4-11)17-8-7-13-9-12(2)10-16-15(13)17;1-2-8-4-3-6(7)5-8/h3-10H,1-2H3;2,6H,1,3-5H2 |
| InChIKey | ZZJJBDUAKOPZKO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine?
The IUPAC name of 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine (CID 176715676) is 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine?
The canonical SMILES for 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine is C=CN1CCC(F)C1.Cc1ccc(-n2ccc3cc(C)cnc32)cc1.
What is the InChIKey of 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine?
The InChIKey is ZZJJBDUAKOPZKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2.C6H10FN/c1-11-3-5-14(6-4-11)17-8-7-13-9-12(2)10-16-15(13)17;1-2-8-4-3-6(7)5-8/h3-10H,1-2H3;2,6H,1,3-5H2.
What are the key properties of 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine?
1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine has a molecular weight of 337.44 g/mol, XLogP of 4.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-fluoropyrrolidine;5-methyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 176715676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).