C23H29F2N5O4S — CID 176715801
4-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]-N-[2-(methanesulfonamido)ethyl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 176715801) has the molecular formula C23H29F2N5O4S and a molecular weight of 509.58 g/mol. Its IUPAC name is 4-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]-N-[2-(methanesulfonamido)ethyl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]-N-[2-(methanesulfonamido)ethyl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 176715801 |
| Molecular Formula | C23H29F2N5O4S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 4-[5-(3,3-difluoro-5-formamidopentyl)pyrrolo[2,3-b]pyridin-1-yl]-N-[2-(methanesulfonamido)ethyl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)C1=CC=C(n2ccc3cc(CCC(F)(F)CCNC=O)cnc32)CC1 |
| InChI | InChI=1S/C23H29F2N5O4S/c1-35(33,34)29-12-11-27-22(32)18-2-4-20(5-3-18)30-13-7-19-14-17(15-28-21(19)30)6-8-23(24,25)9-10-26-16-31/h2,4,7,13-16,29H,3,5-6,8-12H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | LLDFQMJRTYLEAZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|