C28H34BNO3 — CID 176716568
CID 176716568 (PubChem CID 176716568) has the molecular formula C28H34BNO3 and a molecular weight of 443.40 g/mol.
| Compound Name | CID 176716568 |
|---|---|
| PubChem CID | 176716568 |
| Molecular Formula | C28H34BNO3 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | — |
| SMILES | [B]C(=O)C1CCCC[C@@H]1C(=O)Nc1ccc(-c2cccc(OCC)c2C)c(CCC2CC2)c1 |
| InChI | InChI=1S/C28H34BNO3/c1-3-33-26-10-6-9-22(18(26)2)23-16-15-21(17-20(23)14-13-19-11-12-19)30-28(32)25-8-5-4-7-24(25)27(29)31/h6,9-10,15-17,19,24-25H,3-5,7-8,11-14H2,1-2H3,(H,30,32)/t24?,25-/m0/s1 |
| InChIKey | AQXSNGNVLGFFRM-BBMPLOMVSA-N |
| XLogP | 5.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|