About 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane
2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane (PubChem CID 176716844) has the molecular formula C14H25F3N2O
and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane.
Molecular Properties
| Compound Name | 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane |
| PubChem CID | 176716844 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane |
| SMILES | CCC(C)(F)F.NCC(=O)NC12CCC(F)(CC1)CC2 |
| InChI | InChI=1S/C10H17FN2O.C4H8F2/c11-9-1-4-10(5-2-9,6-3-9)13-8(14)7-12;1-3-4(2,5)6/h1-7,12H2,(H,13,14);3H2,1-2H3 |
| InChIKey | YQCYUAURANFSIV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane?
The IUPAC name of 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane (CID 176716844) is 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane.
What is the SMILES notation for 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane?
The canonical SMILES for 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane is CCC(C)(F)F.NCC(=O)NC12CCC(F)(CC1)CC2.
What is the InChIKey of 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane?
The InChIKey is YQCYUAURANFSIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17FN2O.C4H8F2/c11-9-1-4-10(5-2-9,6-3-9)13-8(14)7-12;1-3-4(2,5)6/h1-7,12H2,(H,13,14);3H2,1-2H3.
What are the key properties of 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane?
2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane has a molecular weight of 294.36 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetamide;2,2-difluorobutane is sourced from PubChem (CID 176716844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).