C26H26ClF2N5 — CID 176717007
7-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-5-chloro-2,3-dimethylimidazo[4,5-b]pyridine (PubChem CID 176717007) has the molecular formula C26H26ClF2N5 and a molecular weight of 481.98 g/mol. Its IUPAC name is 7-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-5-chloro-2,3-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 7-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-5-chloro-2,3-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 176717007 |
| Molecular Formula | C26H26ClF2N5 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 7-[4-[bis(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-5-chloro-2,3-dimethylimidazo[4,5-b]pyridine |
| SMILES | Cc1nc2c(N3CCN(C(c4ccc(F)cc4)c4ccc(F)cc4)CC3C)cc(Cl)nc2n1C |
| InChI | InChI=1S/C26H26ClF2N5/c1-16-15-33(25(18-4-8-20(28)9-5-18)19-6-10-21(29)11-7-19)12-13-34(16)22-14-23(27)31-26-24(22)30-17(2)32(26)3/h4-11,14,16,25H,12-13,15H2,1-3H3 |
| InChIKey | FIIQCWZSWILZLC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|