About 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide
3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide (PubChem CID 176717194) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide |
| PubChem CID | 176717194 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide |
| SMILES | CC1CCCC(O)C1.NC(=O)C1CCCN1 |
| InChI | InChI=1S/C7H14O.C5H10N2O/c1-6-3-2-4-7(8)5-6;6-5(8)4-2-1-3-7-4/h6-8H,2-5H2,1H3;4,7H,1-3H2,(H2,6,8) |
| InChIKey | IWTJIELNVFZMGB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide?
The IUPAC name of 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide (CID 176717194) is 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide.
What is the SMILES notation for 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide?
The canonical SMILES for 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide is CC1CCCC(O)C1.NC(=O)C1CCCN1.
What is the InChIKey of 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide?
The InChIKey is IWTJIELNVFZMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C5H10N2O/c1-6-3-2-4-7(8)5-6;6-5(8)4-2-1-3-7-4/h6-8H,2-5H2,1H3;4,7H,1-3H2,(H2,6,8).
What are the key properties of 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide?
3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide has a molecular weight of 228.34 g/mol, XLogP of 0.78, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclohexan-1-ol;pyrrolidine-2-carboxamide is sourced from PubChem (CID 176717194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).