About cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol
cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol (PubChem CID 176717228) has the molecular formula C14H17ClN2O
and a molecular weight of 264.76 g/mol. Its IUPAC name is cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol |
| PubChem CID | 176717228 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol |
| SMILES | C[C@H]1CC[C@@H](n2nc(Cl)c3ccccc32)CC1O |
| InChI | InChI=1S/C14H17ClN2O/c1-9-6-7-10(8-13(9)18)17-12-5-3-2-4-11(12)14(15)16-17/h2-5,9-10,13,18H,6-8H2,1H3/t9-,10+,13?/m0/s1 |
| InChIKey | VBNGUJNXLDXEKS-RGPRDZHESA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol?
The IUPAC name of cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol (CID 176717228) is cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol.
What is the SMILES notation for cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol?
The canonical SMILES for cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol is C[C@H]1CC[C@@H](n2nc(Cl)c3ccccc32)CC1O.
What is the InChIKey of cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol?
The InChIKey is VBNGUJNXLDXEKS-RGPRDZHESA-N. The full InChI is InChI=1S/C14H17ClN2O/c1-9-6-7-10(8-13(9)18)17-12-5-3-2-4-11(12)14(15)16-17/h2-5,9-10,13,18H,6-8H2,1H3/t9-,10+,13?/m0/s1.
What are the key properties of cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol?
cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol has a molecular weight of 264.76 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,5R)-5-(3-chloroindazol-1-yl)-2-methylcyclohexan-1-ol is sourced from PubChem (CID 176717228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).