C26H32N2O4 — CID 176717278
1-[(6aR,10aR)-6a-hydroxy-2-methoxy-6,10a-dimethyl-5,6,7,8,9,10,11,11b-octahydro-4aH-benzo[b]carbazol-8-yl]-3-ethenyl-4-methylpyrrole-2,5-dione (PubChem CID 176717278) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 1-[(6aR,10aR)-6a-hydroxy-2-methoxy-6,10a-dimethyl-5,6,7,8,9,10,11,11b-octahydro-4aH-benzo[b]carbazol-8-yl]-3-ethenyl-4-methylpyrrole-2,5-dione.
| Compound Name | 1-[(6aR,10aR)-6a-hydroxy-2-methoxy-6,10a-dimethyl-5,6,7,8,9,10,11,11b-octahydro-4aH-benzo[b]carbazol-8-yl]-3-ethenyl-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 176717278 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-[(6aR,10aR)-6a-hydroxy-2-methoxy-6,10a-dimethyl-5,6,7,8,9,10,11,11b-octahydro-4aH-benzo[b]carbazol-8-yl]-3-ethenyl-4-methylpyrrole-2,5-dione |
| SMILES | C=CC1=C(C)C(=O)N(C2CC[C@]3(C)CC4=C(NC5C=CC(OC)=CC45)C(C)[C@]3(O)C2)C1=O |
| InChI | InChI=1S/C26H32N2O4/c1-6-18-14(2)23(29)28(24(18)30)16-9-10-25(4)13-20-19-11-17(32-5)7-8-21(19)27-22(20)15(3)26(25,31)12-16/h6-8,11,15-16,19,21,27,31H,1,9-10,12-13H2,2-5H3/t15?,16?,19?,21?,25-,26-/m1/s1 |
| InChIKey | RWVXYKOHFMUZGC-FJFXDXMLSA-N |
| XLogP | 3.13 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|