About 4-methylidene-2,3-dihydrochromene-5,7-diol
4-methylidene-2,3-dihydrochromene-5,7-diol (PubChem CID 176717402) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-methylidene-2,3-dihydrochromene-5,7-diol.
Molecular Properties
| Compound Name | 4-methylidene-2,3-dihydrochromene-5,7-diol |
| PubChem CID | 176717402 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-methylidene-2,3-dihydrochromene-5,7-diol |
| SMILES | C=C1CCOc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C10H10O3/c1-6-2-3-13-9-5-7(11)4-8(12)10(6)9/h4-5,11-12H,1-3H2 |
| InChIKey | CDQNMFNEKWLOCI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylidene-2,3-dihydrochromene-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-2,3-dihydrochromene-5,7-diol?
The IUPAC name of 4-methylidene-2,3-dihydrochromene-5,7-diol (CID 176717402) is 4-methylidene-2,3-dihydrochromene-5,7-diol.
What is the SMILES notation for 4-methylidene-2,3-dihydrochromene-5,7-diol?
The canonical SMILES for 4-methylidene-2,3-dihydrochromene-5,7-diol is C=C1CCOc2cc(O)cc(O)c21.
What is the InChIKey of 4-methylidene-2,3-dihydrochromene-5,7-diol?
The InChIKey is CDQNMFNEKWLOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-6-2-3-13-9-5-7(11)4-8(12)10(6)9/h4-5,11-12H,1-3H2.
What are the key properties of 4-methylidene-2,3-dihydrochromene-5,7-diol?
4-methylidene-2,3-dihydrochromene-5,7-diol has a molecular weight of 178.19 g/mol, XLogP of 1.89, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-2,3-dihydrochromene-5,7-diol is sourced from PubChem (CID 176717402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).